C9H16N4O3S — CID 167894879
N-[3-[methyl(methylsulfonyl)amino]propyl]-1H-pyrazole-5-carboxamide (PubChem CID 167894879) has the molecular formula C9H16N4O3S and a molecular weight of 260.32 g/mol. Its IUPAC name is N-[3-[methyl(methylsulfonyl)amino]propyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[3-[methyl(methylsulfonyl)amino]propyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 167894879 |
| Molecular Formula | C9H16N4O3S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | N-[3-[methyl(methylsulfonyl)amino]propyl]-1H-pyrazole-5-carboxamide |
| SMILES | CN(CCCNC(=O)c1ccn[nH]1)S(C)(=O)=O |
| InChI | InChI=1S/C9H16N4O3S/c1-13(17(2,15)16)7-3-5-10-9(14)8-4-6-11-12-8/h4,6H,3,5,7H2,1-2H3,(H,10,14)(H,11,12) |
| InChIKey | ULUDPIWEWYBLSY-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|