C11H21IN6O — CID 110018237
N-[2-[[N'-(2-methylpropyl)carbamimidoyl]amino]ethyl]-1H-pyrazole-5-carboxamide;hydroiodide (PubChem CID 110018237) has the molecular formula C11H21IN6O and a molecular weight of 380.23 g/mol. Its IUPAC name is N-[2-[[N'-(2-methylpropyl)carbamimidoyl]amino]ethyl]-1H-pyrazole-5-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N'-(2-methylpropyl)carbamimidoyl]amino]ethyl]-1H-pyrazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 110018237 |
| Molecular Formula | C11H21IN6O |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N-[2-[[N'-(2-methylpropyl)carbamimidoyl]amino]ethyl]-1H-pyrazole-5-carboxamide;hydroiodide |
| SMILES | CC(C)C/N=C(\N)NCCNC(=O)c1ccn[nH]1.I |
| InChI | InChI=1S/C11H20N6O.HI/c1-8(2)7-15-11(12)14-6-5-13-10(18)9-3-4-16-17-9;/h3-4,8H,5-7H2,1-2H3,(H,13,18)(H,16,17)(H3,12,14,15);1H |
| InChIKey | ZXNDTXRCDPOOGT-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|