C14H16F2N4O — CID 86785665
N-[2-[1-(3,4-difluorophenyl)ethylamino]ethyl]-1H-pyrazole-5-carboxamide (PubChem CID 86785665) has the molecular formula C14H16F2N4O and a molecular weight of 294.31 g/mol. Its IUPAC name is N-[2-[1-(3,4-difluorophenyl)ethylamino]ethyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[2-[1-(3,4-difluorophenyl)ethylamino]ethyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 86785665 |
| Molecular Formula | C14H16F2N4O |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | N-[2-[1-(3,4-difluorophenyl)ethylamino]ethyl]-1H-pyrazole-5-carboxamide |
| SMILES | CC(NCCNC(=O)c1ccn[nH]1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H16F2N4O/c1-9(10-2-3-11(15)12(16)8-10)17-6-7-18-14(21)13-4-5-19-20-13/h2-5,8-9,17H,6-7H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | HSAWFHVYNFXZHA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|