C14H13F2N3O — CID 122144923
N-[1-(3,4-difluorophenyl)-2-methylprop-2-enyl]-1H-pyrazole-5-carboxamide (PubChem CID 122144923) has the molecular formula C14H13F2N3O and a molecular weight of 277.27 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)-2-methylprop-2-enyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[1-(3,4-difluorophenyl)-2-methylprop-2-enyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122144923 |
| Molecular Formula | C14H13F2N3O |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)-2-methylprop-2-enyl]-1H-pyrazole-5-carboxamide |
| SMILES | C=C(C)C(NC(=O)c1ccn[nH]1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H13F2N3O/c1-8(2)13(9-3-4-10(15)11(16)7-9)18-14(20)12-5-6-17-19-12/h3-7,13H,1H2,2H3,(H,17,19)(H,18,20) |
| InChIKey | FXKPWKKNRJXBJB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|