C18H22F2N2O3 — CID 122123500
1-[[1-(3,4-difluorophenyl)-2-methylprop-2-enyl]carbamoyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122123500) has the molecular formula C18H22F2N2O3 and a molecular weight of 352.38 g/mol. Its IUPAC name is 1-[[1-(3,4-difluorophenyl)-2-methylprop-2-enyl]carbamoyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[[1-(3,4-difluorophenyl)-2-methylprop-2-enyl]carbamoyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122123500 |
| Molecular Formula | C18H22F2N2O3 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-[[1-(3,4-difluorophenyl)-2-methylprop-2-enyl]carbamoyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | C=C(C)C(NC(=O)N1CC(C)CC(C(=O)O)C1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H22F2N2O3/c1-10(2)16(12-4-5-14(19)15(20)7-12)21-18(25)22-8-11(3)6-13(9-22)17(23)24/h4-5,7,11,13,16H,1,6,8-9H2,2-3H3,(H,21,25)(H,23,24) |
| InChIKey | HSZKVDCKMCBHFQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|