C14H19F3N4O2 — CID 99782382
N-[2-[[(1R,2R)-2-(trifluoromethyl)cyclohexanecarbonyl]amino]ethyl]-1H-pyrazole-5-carboxamide (PubChem CID 99782382) has the molecular formula C14H19F3N4O2 and a molecular weight of 332.33 g/mol. Its IUPAC name is N-[2-[[(1R,2R)-2-(trifluoromethyl)cyclohexanecarbonyl]amino]ethyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[2-[[(1R,2R)-2-(trifluoromethyl)cyclohexanecarbonyl]amino]ethyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 99782382 |
| Molecular Formula | C14H19F3N4O2 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-[2-[[(1R,2R)-2-(trifluoromethyl)cyclohexanecarbonyl]amino]ethyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCCNC(=O)[C@@H]1CCCC[C@H]1C(F)(F)F)c1ccn[nH]1 |
| InChI | InChI=1S/C14H19F3N4O2/c15-14(16,17)10-4-2-1-3-9(10)12(22)18-7-8-19-13(23)11-5-6-20-21-11/h5-6,9-10H,1-4,7-8H2,(H,18,22)(H,19,23)(H,20,21)/t9-,10-/m1/s1 |
| InChIKey | VFYICYDGBYIIJB-NXEZZACHSA-N |
| XLogP | 1.62 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|