C15H23N5O2 — CID 97346303
(4aR,7aR)-N-[2-(1H-pyrazole-5-carbonylamino)ethyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxamide (PubChem CID 97346303) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is (4aR,7aR)-N-[2-(1H-pyrazole-5-carbonylamino)ethyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxamide.
| Compound Name | (4aR,7aR)-N-[2-(1H-pyrazole-5-carbonylamino)ethyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 97346303 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | (4aR,7aR)-N-[2-(1H-pyrazole-5-carbonylamino)ethyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxamide |
| SMILES | O=C(NCCNC(=O)N1CCC[C@H]2CCC[C@H]21)c1ccn[nH]1 |
| InChI | InChI=1S/C15H23N5O2/c21-14(12-6-7-18-19-12)16-8-9-17-15(22)20-10-2-4-11-3-1-5-13(11)20/h6-7,11,13H,1-5,8-10H2,(H,16,21)(H,17,22)(H,18,19)/t11-,13-/m1/s1 |
| InChIKey | FWJVCRDGYNTHMF-DGCLKSJQSA-N |
| XLogP | 1.11 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|