C11H19IN6O — CID 110017703
N-[2-[(N-cyclopropyl-N'-methylcarbamimidoyl)amino]ethyl]-1H-pyrazole-5-carboxamide;hydroiodide (PubChem CID 110017703) has the molecular formula C11H19IN6O and a molecular weight of 378.22 g/mol. Its IUPAC name is N-[2-[(N-cyclopropyl-N'-methylcarbamimidoyl)amino]ethyl]-1H-pyrazole-5-carboxamide;hydroiodide.
| Compound Name | N-[2-[(N-cyclopropyl-N'-methylcarbamimidoyl)amino]ethyl]-1H-pyrazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 110017703 |
| Molecular Formula | C11H19IN6O |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | N-[2-[(N-cyclopropyl-N'-methylcarbamimidoyl)amino]ethyl]-1H-pyrazole-5-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1ccn[nH]1)NC1CC1.I |
| InChI | InChI=1S/C11H18N6O.HI/c1-12-11(16-8-2-3-8)14-7-6-13-10(18)9-4-5-15-17-9;/h4-5,8H,2-3,6-7H2,1H3,(H,13,18)(H,15,17)(H2,12,14,16);1H |
| InChIKey | LWSGZXLBCPCGJH-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|