C12H19IN4 — CID 110933648
1-cyclopropyl-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 110933648) has the molecular formula C12H19IN4 and a molecular weight of 346.22 g/mol. Its IUPAC name is 1-cyclopropyl-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110933648 |
| Molecular Formula | C12H19IN4 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 1-cyclopropyl-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccccn1)NC1CC1.I |
| InChI | InChI=1S/C12H18N4.HI/c1-13-12(16-11-5-6-11)15-9-7-10-4-2-3-8-14-10;/h2-4,8,11H,5-7,9H2,1H3,(H2,13,15,16);1H |
| InChIKey | FBAUVUKIWFXUFF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|