C17H27IN4 — CID 111500308
1-(2,2-dicyclopropylethyl)-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111500308) has the molecular formula C17H27IN4 and a molecular weight of 414.34 g/mol. Its IUPAC name is 1-(2,2-dicyclopropylethyl)-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-(2,2-dicyclopropylethyl)-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111500308 |
| Molecular Formula | C17H27IN4 |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 1-(2,2-dicyclopropylethyl)-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccccn1)NCC(C1CC1)C1CC1.I |
| InChI | InChI=1S/C17H26N4.HI/c1-18-17(20-11-9-15-4-2-3-10-19-15)21-12-16(13-5-6-13)14-7-8-14;/h2-4,10,13-14,16H,5-9,11-12H2,1H3,(H2,18,20,21);1H |
| InChIKey | WKARISIGIYTBFR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|