C10H17BN4O2 — CID 153412370
methyl-[4-(1H-pyrazole-5-carbonylamino)piperidin-1-yl]borinic acid (PubChem CID 153412370) has the molecular formula C10H17BN4O2 and a molecular weight of 236.08 g/mol. Its IUPAC name is methyl-[4-(1H-pyrazole-5-carbonylamino)piperidin-1-yl]borinic acid.
| Compound Name | methyl-[4-(1H-pyrazole-5-carbonylamino)piperidin-1-yl]borinic acid |
|---|---|
| PubChem CID | 153412370 |
| Molecular Formula | C10H17BN4O2 |
| Molecular Weight | 236.08 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | methyl-[4-(1H-pyrazole-5-carbonylamino)piperidin-1-yl]borinic acid |
| SMILES | CB(O)N1CCC(NC(=O)c2ccn[nH]2)CC1 |
| InChI | InChI=1S/C10H17BN4O2/c1-11(17)15-6-3-8(4-7-15)13-10(16)9-2-5-12-14-9/h2,5,8,17H,3-4,6-7H2,1H3,(H,12,14)(H,13,16) |
| InChIKey | IXKAZZPAUUXANU-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.08 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|