C10H15N3O2 — CID 114630425
N-(3-hydroxy-2,2-dimethylcyclobutyl)-1H-pyrazole-5-carboxamide (PubChem CID 114630425) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is N-(3-hydroxy-2,2-dimethylcyclobutyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(3-hydroxy-2,2-dimethylcyclobutyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 114630425 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-(3-hydroxy-2,2-dimethylcyclobutyl)-1H-pyrazole-5-carboxamide |
| SMILES | CC1(C)C(O)CC1NC(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C10H15N3O2/c1-10(2)7(5-8(10)14)12-9(15)6-3-4-11-13-6/h3-4,7-8,14H,5H2,1-2H3,(H,11,13)(H,12,15) |
| InChIKey | LYYUMIYFZLFSBU-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |