About 1H-pyrazole-5-carboxylic acid;zinc
1H-pyrazole-5-carboxylic acid;zinc (PubChem CID 158581218) has the molecular formula C4H4N2O2Zn
and a molecular weight of 177.48 g/mol. Its IUPAC name is 1H-pyrazole-5-carboxylic acid;zinc.
Molecular Properties
| Compound Name | 1H-pyrazole-5-carboxylic acid;zinc |
| PubChem CID | 158581218 |
| Molecular Formula | C4H4N2O2Zn |
| Molecular Weight | 177.48 g/mol |
| Exact Mass | 175.96 |
| IUPAC Name | 1H-pyrazole-5-carboxylic acid;zinc |
| SMILES | O=C(O)c1ccn[nH]1.[Zn] |
| InChI | InChI=1S/C4H4N2O2.Zn/c7-4(8)3-1-2-5-6-3;/h1-2H,(H,5,6)(H,7,8); |
| InChIKey | HTGSHEPABSGLFD-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.48 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrazole-5-carboxylic acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazole-5-carboxylic acid;zinc?
The IUPAC name of 1H-pyrazole-5-carboxylic acid;zinc (CID 158581218) is 1H-pyrazole-5-carboxylic acid;zinc.
What is the SMILES notation for 1H-pyrazole-5-carboxylic acid;zinc?
The canonical SMILES for 1H-pyrazole-5-carboxylic acid;zinc is O=C(O)c1ccn[nH]1.[Zn].
What is the InChIKey of 1H-pyrazole-5-carboxylic acid;zinc?
The InChIKey is HTGSHEPABSGLFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2.Zn/c7-4(8)3-1-2-5-6-3;/h1-2H,(H,5,6)(H,7,8);.
What are the key properties of 1H-pyrazole-5-carboxylic acid;zinc?
1H-pyrazole-5-carboxylic acid;zinc has a molecular weight of 177.48 g/mol, XLogP of 0.11, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazole-5-carboxylic acid;zinc is sourced from PubChem (CID 158581218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).