About dihydroxy(oxo)phosphanium;1H-pyrazole-5-carboxylic acid
dihydroxy(oxo)phosphanium;1H-pyrazole-5-carboxylic acid (PubChem CID 158864481) has the molecular formula C4H6N2O5P+
and a molecular weight of 193.07 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;1H-pyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;1H-pyrazole-5-carboxylic acid |
| PubChem CID | 158864481 |
| Molecular Formula | C4H6N2O5P+ |
| Molecular Weight | 193.07 g/mol |
| Exact Mass | 193.00 |
| IUPAC Name | dihydroxy(oxo)phosphanium;1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccn[nH]1.O=[P+](O)O |
| InChI | InChI=1S/C4H4N2O2.HO3P/c7-4(8)3-1-2-5-6-3;1-4(2)3/h1-2H,(H,5,6)(H,7,8);(H-,1,2,3)/p+1 |
| InChIKey | OMDAHOMPBONDCB-UHFFFAOYSA-O |
| XLogP | -0.26 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.07 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;1H-pyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;1H-pyrazole-5-carboxylic acid?
The IUPAC name of dihydroxy(oxo)phosphanium;1H-pyrazole-5-carboxylic acid (CID 158864481) is dihydroxy(oxo)phosphanium;1H-pyrazole-5-carboxylic acid.
What is the SMILES notation for dihydroxy(oxo)phosphanium;1H-pyrazole-5-carboxylic acid?
The canonical SMILES for dihydroxy(oxo)phosphanium;1H-pyrazole-5-carboxylic acid is O=C(O)c1ccn[nH]1.O=[P+](O)O.
What is the InChIKey of dihydroxy(oxo)phosphanium;1H-pyrazole-5-carboxylic acid?
The InChIKey is OMDAHOMPBONDCB-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H4N2O2.HO3P/c7-4(8)3-1-2-5-6-3;1-4(2)3/h1-2H,(H,5,6)(H,7,8);(H-,1,2,3)/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;1H-pyrazole-5-carboxylic acid?
dihydroxy(oxo)phosphanium;1H-pyrazole-5-carboxylic acid has a molecular weight of 193.07 g/mol, XLogP of -0.26, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;1H-pyrazole-5-carboxylic acid is sourced from PubChem (CID 158864481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).