About 3-ethyl-1H-indole;1H-pyrazole-5-carboxylic acid
3-ethyl-1H-indole;1H-pyrazole-5-carboxylic acid (PubChem CID 157088032) has the molecular formula C14H15N3O2
and a molecular weight of 257.29 g/mol. Its IUPAC name is 3-ethyl-1H-indole;1H-pyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-ethyl-1H-indole;1H-pyrazole-5-carboxylic acid |
| PubChem CID | 157088032 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-ethyl-1H-indole;1H-pyrazole-5-carboxylic acid |
| SMILES | CCc1c[nH]c2ccccc12.O=C(O)c1ccn[nH]1 |
| InChI | InChI=1S/C10H11N.C4H4N2O2/c1-2-8-7-11-10-6-4-3-5-9(8)10;7-4(8)3-1-2-5-6-3/h3-7,11H,2H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | AEHYNRCCJGUXJL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-1H-indole;1H-pyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1H-indole;1H-pyrazole-5-carboxylic acid?
The IUPAC name of 3-ethyl-1H-indole;1H-pyrazole-5-carboxylic acid (CID 157088032) is 3-ethyl-1H-indole;1H-pyrazole-5-carboxylic acid.
What is the SMILES notation for 3-ethyl-1H-indole;1H-pyrazole-5-carboxylic acid?
The canonical SMILES for 3-ethyl-1H-indole;1H-pyrazole-5-carboxylic acid is CCc1c[nH]c2ccccc12.O=C(O)c1ccn[nH]1.
What is the InChIKey of 3-ethyl-1H-indole;1H-pyrazole-5-carboxylic acid?
The InChIKey is AEHYNRCCJGUXJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N.C4H4N2O2/c1-2-8-7-11-10-6-4-3-5-9(8)10;7-4(8)3-1-2-5-6-3/h3-7,11H,2H2,1H3;1-2H,(H,5,6)(H,7,8).
What are the key properties of 3-ethyl-1H-indole;1H-pyrazole-5-carboxylic acid?
3-ethyl-1H-indole;1H-pyrazole-5-carboxylic acid has a molecular weight of 257.29 g/mol, XLogP of 2.84, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1H-indole;1H-pyrazole-5-carboxylic acid is sourced from PubChem (CID 157088032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).