About piperidin-1-amine;1H-pyrazole-5-carboxylic acid
piperidin-1-amine;1H-pyrazole-5-carboxylic acid (PubChem CID 172745685) has the molecular formula C9H16N4O2
and a molecular weight of 212.25 g/mol. Its IUPAC name is piperidin-1-amine;1H-pyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | piperidin-1-amine;1H-pyrazole-5-carboxylic acid |
| PubChem CID | 172745685 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | piperidin-1-amine;1H-pyrazole-5-carboxylic acid |
| SMILES | NN1CCCCC1.O=C(O)c1ccn[nH]1 |
| InChI | InChI=1S/C5H12N2.C4H4N2O2/c6-7-4-2-1-3-5-7;7-4(8)3-1-2-5-6-3/h1-6H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | JROVUUXOKZALIG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze piperidin-1-amine;1H-pyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-1-amine;1H-pyrazole-5-carboxylic acid?
The IUPAC name of piperidin-1-amine;1H-pyrazole-5-carboxylic acid (CID 172745685) is piperidin-1-amine;1H-pyrazole-5-carboxylic acid.
What is the SMILES notation for piperidin-1-amine;1H-pyrazole-5-carboxylic acid?
The canonical SMILES for piperidin-1-amine;1H-pyrazole-5-carboxylic acid is NN1CCCCC1.O=C(O)c1ccn[nH]1.
What is the InChIKey of piperidin-1-amine;1H-pyrazole-5-carboxylic acid?
The InChIKey is JROVUUXOKZALIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2.C4H4N2O2/c6-7-4-2-1-3-5-7;7-4(8)3-1-2-5-6-3/h1-6H2;1-2H,(H,5,6)(H,7,8).
What are the key properties of piperidin-1-amine;1H-pyrazole-5-carboxylic acid?
piperidin-1-amine;1H-pyrazole-5-carboxylic acid has a molecular weight of 212.25 g/mol, XLogP of 0.45, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-1-amine;1H-pyrazole-5-carboxylic acid is sourced from PubChem (CID 172745685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).