About copper(1+);1H-pyrazole-5-carboxylate
copper(1+);1H-pyrazole-5-carboxylate (PubChem CID 70037114) has the molecular formula C4H3CuN2O2
and a molecular weight of 174.63 g/mol. Its IUPAC name is copper(1+);1H-pyrazole-5-carboxylate.
Molecular Properties
| Compound Name | copper(1+);1H-pyrazole-5-carboxylate |
| PubChem CID | 70037114 |
| Molecular Formula | C4H3CuN2O2 |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 173.95 |
| IUPAC Name | copper(1+);1H-pyrazole-5-carboxylate |
| SMILES | O=C([O-])c1ccn[nH]1.[Cu+] |
| InChI | InChI=1S/C4H4N2O2.Cu/c7-4(8)3-1-2-5-6-3;/h1-2H,(H,5,6)(H,7,8);/q;+1/p-1 |
| InChIKey | OFHVUQMLCUNQHZ-UHFFFAOYSA-M |
| XLogP | -1.23 |
| TPSA | 68.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze copper(1+);1H-pyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);1H-pyrazole-5-carboxylate?
The IUPAC name of copper(1+);1H-pyrazole-5-carboxylate (CID 70037114) is copper(1+);1H-pyrazole-5-carboxylate.
What is the SMILES notation for copper(1+);1H-pyrazole-5-carboxylate?
The canonical SMILES for copper(1+);1H-pyrazole-5-carboxylate is O=C([O-])c1ccn[nH]1.[Cu+].
What is the InChIKey of copper(1+);1H-pyrazole-5-carboxylate?
The InChIKey is OFHVUQMLCUNQHZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H4N2O2.Cu/c7-4(8)3-1-2-5-6-3;/h1-2H,(H,5,6)(H,7,8);/q;+1/p-1.
What are the key properties of copper(1+);1H-pyrazole-5-carboxylate?
copper(1+);1H-pyrazole-5-carboxylate has a molecular weight of 174.63 g/mol, XLogP of -1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);1H-pyrazole-5-carboxylate is sourced from PubChem (CID 70037114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).