C11H16N2O3 — CID 107261784
N-(4-methoxybutyl)-6-oxo-1H-pyridine-2-carboxamide (PubChem CID 107261784) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is N-(4-methoxybutyl)-6-oxo-1H-pyridine-2-carboxamide.
| Compound Name | N-(4-methoxybutyl)-6-oxo-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107261784 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | N-(4-methoxybutyl)-6-oxo-1H-pyridine-2-carboxamide |
| SMILES | COCCCCNC(=O)c1cccc(=O)[nH]1 |
| InChI | InChI=1S/C11H16N2O3/c1-16-8-3-2-7-12-11(15)9-5-4-6-10(14)13-9/h4-6H,2-3,7-8H2,1H3,(H,12,15)(H,13,14) |
| InChIKey | ZELUFNDPQJEBHD-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|