C15H13ClF3N3O — CID 3818400
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2-pyridin-3-ylethyl)urea (PubChem CID 3818400) has the molecular formula C15H13ClF3N3O and a molecular weight of 343.74 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2-pyridin-3-ylethyl)urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2-pyridin-3-ylethyl)urea |
|---|---|
| PubChem CID | 3818400 |
| Molecular Formula | C15H13ClF3N3O |
| Molecular Weight | 343.74 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2-pyridin-3-ylethyl)urea |
| SMILES | O=C(NCCc1cccnc1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H13ClF3N3O/c16-13-4-3-11(8-12(13)15(17,18)19)22-14(23)21-7-5-10-2-1-6-20-9-10/h1-4,6,8-9H,5,7H2,(H2,21,22,23) |
| InChIKey | WSUIXJKCPQHGBK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.74 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |