C21H17ClF3N3O — CID 59708540
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[[3-(6-methyl-3-pyridinyl)phenyl]methyl]urea (PubChem CID 59708540) has the molecular formula C21H17ClF3N3O and a molecular weight of 419.83 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[[3-(6-methyl-3-pyridinyl)phenyl]methyl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[[3-(6-methyl-3-pyridinyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 59708540 |
| Molecular Formula | C21H17ClF3N3O |
| Molecular Weight | 419.83 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[[3-(6-methyl-3-pyridinyl)phenyl]methyl]urea |
| SMILES | Cc1ccc(-c2cccc(CNC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)c2)cn1 |
| InChI | InChI=1S/C21H17ClF3N3O/c1-13-5-6-16(12-26-13)15-4-2-3-14(9-15)11-27-20(29)28-17-7-8-19(22)18(10-17)21(23,24)25/h2-10,12H,11H2,1H3,(H2,27,28,29) |
| InChIKey | AEFAOOHTJWMXDD-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.83 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |