C22H18ClF3N2O2 — CID 3668658
1-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-3-(4-phenylmethoxyphenyl)urea (PubChem CID 3668658) has the molecular formula C22H18ClF3N2O2 and a molecular weight of 434.85 g/mol. Its IUPAC name is 1-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-3-(4-phenylmethoxyphenyl)urea.
| Compound Name | 1-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-3-(4-phenylmethoxyphenyl)urea |
|---|---|
| PubChem CID | 3668658 |
| Molecular Formula | C22H18ClF3N2O2 |
| Molecular Weight | 434.85 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 1-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-3-(4-phenylmethoxyphenyl)urea |
| SMILES | O=C(NCc1ccc(Cl)c(C(F)(F)F)c1)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H18ClF3N2O2/c23-20-11-6-16(12-19(20)22(24,25)26)13-27-21(29)28-17-7-9-18(10-8-17)30-14-15-4-2-1-3-5-15/h1-12H,13-14H2,(H2,27,28,29) |
| InChIKey | IVXYVGASUWGENB-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.85 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |