C12H15N3O6S — CID 135467718
methyl (E)-3-hydroxy-4-methoxy-2-[(4-sulfamoylphenyl)diazenyl]but-2-enoate (PubChem CID 135467718) has the molecular formula C12H15N3O6S and a molecular weight of 329.33 g/mol. Its IUPAC name is methyl (E)-3-hydroxy-4-methoxy-2-[(4-sulfamoylphenyl)diazenyl]but-2-enoate.
| Compound Name | methyl (E)-3-hydroxy-4-methoxy-2-[(4-sulfamoylphenyl)diazenyl]but-2-enoate |
|---|---|
| PubChem CID | 135467718 |
| Molecular Formula | C12H15N3O6S |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | methyl (E)-3-hydroxy-4-methoxy-2-[(4-sulfamoylphenyl)diazenyl]but-2-enoate |
| SMILES | COC/C(O)=C(\N=N\c1ccc(S(N)(=O)=O)cc1)C(=O)OC |
| InChI | InChI=1S/C12H15N3O6S/c1-20-7-10(16)11(12(17)21-2)15-14-8-3-5-9(6-4-8)22(13,18)19/h3-6,16H,7H2,1-2H3,(H2,13,18,19)/b11-10+,15-14+ |
| InChIKey | IBRQZRIIAIKYHY-RICRECKTSA-N |
| XLogP | 1.01 |
| TPSA | 140.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|