C19H20N4O6S2 — CID 137122925
methyl 2-[[3-hydroxy-2-[(4-sulfamoylphenyl)diazenyl]but-2-enoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 137122925) has the molecular formula C19H20N4O6S2 and a molecular weight of 464.53 g/mol. Its IUPAC name is methyl 2-[[3-hydroxy-2-[(4-sulfamoylphenyl)diazenyl]but-2-enoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[3-hydroxy-2-[(4-sulfamoylphenyl)diazenyl]but-2-enoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 137122925 |
| Molecular Formula | C19H20N4O6S2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | methyl 2-[[3-hydroxy-2-[(4-sulfamoylphenyl)diazenyl]but-2-enoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(/N=N/c2ccc(S(N)(=O)=O)cc2)=C(C)O)sc2c1CCC2 |
| InChI | InChI=1S/C19H20N4O6S2/c1-10(24)16(23-22-11-6-8-12(9-7-11)31(20,27)28)17(25)21-18-15(19(26)29-2)13-4-3-5-14(13)30-18/h6-9,24H,3-5H2,1-2H3,(H,21,25)(H2,20,27,28)/b16-10?,23-22+ |
| InChIKey | FRMWTHLJBDLTJH-VNZMLDBOSA-N |
| XLogP | 3.18 |
| TPSA | 160.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|