C23H27N3O6S — CID 135461345
methyl 2-[[(E)-2-[(3,4-diethoxyphenyl)diazenyl]-3-hydroxybut-2-enoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 135461345) has the molecular formula C23H27N3O6S and a molecular weight of 473.55 g/mol. Its IUPAC name is methyl 2-[[(E)-2-[(3,4-diethoxyphenyl)diazenyl]-3-hydroxybut-2-enoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[(E)-2-[(3,4-diethoxyphenyl)diazenyl]-3-hydroxybut-2-enoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 135461345 |
| Molecular Formula | C23H27N3O6S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | methyl 2-[[(E)-2-[(3,4-diethoxyphenyl)diazenyl]-3-hydroxybut-2-enoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | CCOc1ccc(/N=N/C(C(=O)Nc2sc3c(c2C(=O)OC)CCC3)=C(\C)O)cc1OCC |
| InChI | InChI=1S/C23H27N3O6S/c1-5-31-16-11-10-14(12-17(16)32-6-2)25-26-20(13(3)27)21(28)24-22-19(23(29)30-4)15-8-7-9-18(15)33-22/h10-12,27H,5-9H2,1-4H3,(H,24,28)/b20-13+,26-25+ |
| InChIKey | JQQHJMVJRDPHAA-VCKHZNEVSA-N |
| XLogP | 5.33 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|