C10H12ClN3O4S — CID 90698371
ethyl 2-chloro-2-[(4-sulfamoylphenyl)diazenyl]acetate (PubChem CID 90698371) has the molecular formula C10H12ClN3O4S and a molecular weight of 305.74 g/mol. Its IUPAC name is ethyl 2-chloro-2-[(4-sulfamoylphenyl)diazenyl]acetate.
| Compound Name | ethyl 2-chloro-2-[(4-sulfamoylphenyl)diazenyl]acetate |
|---|---|
| PubChem CID | 90698371 |
| Molecular Formula | C10H12ClN3O4S |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | ethyl 2-chloro-2-[(4-sulfamoylphenyl)diazenyl]acetate |
| SMILES | CCOC(=O)C(Cl)/N=N/c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C10H12ClN3O4S/c1-2-18-10(15)9(11)14-13-7-3-5-8(6-4-7)19(12,16)17/h3-6,9H,2H2,1H3,(H2,12,16,17)/b14-13+ |
| InChIKey | HJFIPIYEAMVECL-BUHFOSPRSA-N |
| XLogP | 1.55 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|