C11H12N4O4S — CID 170922609
ethyl 2-cyano-2-[(4-sulfamoylphenyl)diazenyl]acetate (PubChem CID 170922609) has the molecular formula C11H12N4O4S and a molecular weight of 296.31 g/mol. Its IUPAC name is ethyl 2-cyano-2-[(4-sulfamoylphenyl)diazenyl]acetate.
| Compound Name | ethyl 2-cyano-2-[(4-sulfamoylphenyl)diazenyl]acetate |
|---|---|
| PubChem CID | 170922609 |
| Molecular Formula | C11H12N4O4S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | ethyl 2-cyano-2-[(4-sulfamoylphenyl)diazenyl]acetate |
| SMILES | CCOC(=O)C(C#N)/N=N/c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H12N4O4S/c1-2-19-11(16)10(7-12)15-14-8-3-5-9(6-4-8)20(13,17)18/h3-6,10H,2H2,1H3,(H2,13,17,18)/b15-14+ |
| InChIKey | PZHKNNWHXQZCIG-CCEZHUSRSA-N |
| XLogP | 0.87 |
| TPSA | 134.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|