C28H27N4O4PS — CID 91348217
ethyl 2-[(4-sulfamoylphenyl)diazenyl]-2-[(triphenyl-λ5-phosphanylidene)amino]acetate (PubChem CID 91348217) has the molecular formula C28H27N4O4PS and a molecular weight of 546.59 g/mol. Its IUPAC name is ethyl 2-[(4-sulfamoylphenyl)diazenyl]-2-[(triphenyl-λ5-phosphanylidene)amino]acetate.
| Compound Name | ethyl 2-[(4-sulfamoylphenyl)diazenyl]-2-[(triphenyl-λ5-phosphanylidene)amino]acetate |
|---|---|
| PubChem CID | 91348217 |
| Molecular Formula | C28H27N4O4PS |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | ethyl 2-[(4-sulfamoylphenyl)diazenyl]-2-[(triphenyl-λ5-phosphanylidene)amino]acetate |
| SMILES | CCOC(=O)C(N=P(c1ccccc1)(c1ccccc1)c1ccccc1)/N=N/c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C28H27N4O4PS/c1-2-36-28(33)27(31-30-22-18-20-26(21-19-22)38(29,34)35)32-37(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-21,27H,2H2,1H3,(H2,29,34,35)/b31-30+ |
| InChIKey | HEWPZIZQIUEFOI-NVQSTNCTSA-N |
| XLogP | 4.48 |
| TPSA | 123.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|