C21H21N3O5S3 — CID 137004511
ethyl 2-[4-hydroxy-5-[(4-sulfamoylphenyl)iminomethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-3-phenylpropanoate (PubChem CID 137004511) has the molecular formula C21H21N3O5S3 and a molecular weight of 491.62 g/mol. Its IUPAC name is ethyl 2-[4-hydroxy-5-[(4-sulfamoylphenyl)iminomethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-3-phenylpropanoate.
| Compound Name | ethyl 2-[4-hydroxy-5-[(4-sulfamoylphenyl)iminomethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 137004511 |
| Molecular Formula | C21H21N3O5S3 |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | ethyl 2-[4-hydroxy-5-[(4-sulfamoylphenyl)iminomethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-3-phenylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)n1c(O)c(/C=N/c2ccc(S(N)(=O)=O)cc2)sc1=S |
| InChI | InChI=1S/C21H21N3O5S3/c1-2-29-20(26)17(12-14-6-4-3-5-7-14)24-19(25)18(31-21(24)30)13-23-15-8-10-16(11-9-15)32(22,27)28/h3-11,13,17,25H,2,12H2,1H3,(H2,22,27,28)/b23-13+ |
| InChIKey | SZZBVCCGJIJMAG-YDZHTSKRSA-N |
| XLogP | 3.73 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|