C22H22N2O3S2 — CID 137091508
ethyl (2R)-2-[5-(benzyliminomethyl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]-3-phenylpropanoate (PubChem CID 137091508) has the molecular formula C22H22N2O3S2 and a molecular weight of 426.56 g/mol. Its IUPAC name is ethyl (2R)-2-[5-(benzyliminomethyl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]-3-phenylpropanoate.
| Compound Name | ethyl (2R)-2-[5-(benzyliminomethyl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 137091508 |
| Molecular Formula | C22H22N2O3S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | ethyl (2R)-2-[5-(benzyliminomethyl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@@H](Cc1ccccc1)n1c(O)c(/C=N/Cc2ccccc2)sc1=S |
| InChI | InChI=1S/C22H22N2O3S2/c1-2-27-21(26)18(13-16-9-5-3-6-10-16)24-20(25)19(29-22(24)28)15-23-14-17-11-7-4-8-12-17/h3-12,15,18,25H,2,13-14H2,1H3/b23-15+/t18-/m1/s1 |
| InChIKey | DCBTVCDWXVRIAZ-MMTNMYCKSA-N |
| XLogP | 4.95 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|