C15H18N2O4 — CID 139636721
ethyl 2-(3-amino-2,5-dioxopyrrolidin-1-yl)-3-phenylpropanoate (PubChem CID 139636721) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is ethyl 2-(3-amino-2,5-dioxopyrrolidin-1-yl)-3-phenylpropanoate.
| Compound Name | ethyl 2-(3-amino-2,5-dioxopyrrolidin-1-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 139636721 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | ethyl 2-(3-amino-2,5-dioxopyrrolidin-1-yl)-3-phenylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)N1C(=O)CC(N)C1=O |
| InChI | InChI=1S/C15H18N2O4/c1-2-21-15(20)12(8-10-6-4-3-5-7-10)17-13(18)9-11(16)14(17)19/h3-7,11-12H,2,8-9,16H2,1H3 |
| InChIKey | QXNABQFOVRFDQX-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|