C16H20N2O4 — CID 101253204
ethyl (2S)-2-(3,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-phenylpropanoate (PubChem CID 101253204) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is ethyl (2S)-2-(3,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-phenylpropanoate.
| Compound Name | ethyl (2S)-2-(3,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 101253204 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | ethyl (2S)-2-(3,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccccc1)N1C(=O)C(C)N(C)C1=O |
| InChI | InChI=1S/C16H20N2O4/c1-4-22-15(20)13(10-12-8-6-5-7-9-12)18-14(19)11(2)17(3)16(18)21/h5-9,11,13H,4,10H2,1-3H3/t11?,13-/m0/s1 |
| InChIKey | LSMNUILWPBNUQO-YUZLPWPTSA-N |
| XLogP | 1.44 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|