C15H15Cl2NO3 — CID 135710932
ethyl (2R)-2-(3,4-dichloro-5-oxo-2H-pyrrol-1-yl)-3-phenylpropanoate (PubChem CID 135710932) has the molecular formula C15H15Cl2NO3 and a molecular weight of 328.20 g/mol. Its IUPAC name is ethyl (2R)-2-(3,4-dichloro-5-oxo-2H-pyrrol-1-yl)-3-phenylpropanoate.
| Compound Name | ethyl (2R)-2-(3,4-dichloro-5-oxo-2H-pyrrol-1-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 135710932 |
| Molecular Formula | C15H15Cl2NO3 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | ethyl (2R)-2-(3,4-dichloro-5-oxo-2H-pyrrol-1-yl)-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@@H](Cc1ccccc1)N1CC(Cl)=C(Cl)C1=O |
| InChI | InChI=1S/C15H15Cl2NO3/c1-2-21-15(20)12(8-10-6-4-3-5-7-10)18-9-11(16)13(17)14(18)19/h3-7,12H,2,8-9H2,1H3/t12-/m1/s1 |
| InChIKey | SFPRVPIXBGEVBT-GFCCVEGCSA-N |
| XLogP | 2.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |