C14H14N2O4S — CID 135941213
ethyl 4-[(4-hydroxy-3-methyl-2-oxo-1,3-thiazol-5-yl)methylideneamino]benzoate (PubChem CID 135941213) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is ethyl 4-[(4-hydroxy-3-methyl-2-oxo-1,3-thiazol-5-yl)methylideneamino]benzoate.
| Compound Name | ethyl 4-[(4-hydroxy-3-methyl-2-oxo-1,3-thiazol-5-yl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 135941213 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | ethyl 4-[(4-hydroxy-3-methyl-2-oxo-1,3-thiazol-5-yl)methylideneamino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C/c2sc(=O)n(C)c2O)cc1 |
| InChI | InChI=1S/C14H14N2O4S/c1-3-20-13(18)9-4-6-10(7-5-9)15-8-11-12(17)16(2)14(19)21-11/h4-8,17H,3H2,1-2H3/b15-8+ |
| InChIKey | XSEORCUDPSPZHB-OVCLIPMQSA-N |
| XLogP | 2.08 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|