C28H29N4O4PS — CID 143624057
ethyl (2E)-2-[[cyclohexa-1,5-dien-1-yl(diphenyl)-λ5-phosphanylidene]amino]-2-[(4-sulfamoylphenyl)hydrazinylidene]acetate (PubChem CID 143624057) has the molecular formula C28H29N4O4PS and a molecular weight of 548.61 g/mol. Its IUPAC name is ethyl (2E)-2-[[cyclohexa-1,5-dien-1-yl(diphenyl)-λ5-phosphanylidene]amino]-2-[(4-sulfamoylphenyl)hydrazinylidene]acetate.
| Compound Name | ethyl (2E)-2-[[cyclohexa-1,5-dien-1-yl(diphenyl)-λ5-phosphanylidene]amino]-2-[(4-sulfamoylphenyl)hydrazinylidene]acetate |
|---|---|
| PubChem CID | 143624057 |
| Molecular Formula | C28H29N4O4PS |
| Molecular Weight | 548.61 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | ethyl (2E)-2-[[cyclohexa-1,5-dien-1-yl(diphenyl)-λ5-phosphanylidene]amino]-2-[(4-sulfamoylphenyl)hydrazinylidene]acetate |
| SMILES | CCOC(=O)/C(N=P(C1=CCCC=C1)(c1ccccc1)c1ccccc1)=N\Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C28H29N4O4PS/c1-2-36-28(33)27(31-30-22-18-20-26(21-19-22)38(29,34)35)32-37(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-4,6-10,12-21,30H,2,5,11H2,1H3,(H2,29,34,35)/b31-27+ |
| InChIKey | AUAKRSOZEQJXPR-TVKQRKNISA-N |
| XLogP | 4.71 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|