C12H10BrF3N2O3 — CID 163256017
ethyl (E)-2-[(4-bromophenyl)diazenyl]-4,4,4-trifluoro-3-hydroxybut-2-enoate (PubChem CID 163256017) has the molecular formula C12H10BrF3N2O3 and a molecular weight of 367.12 g/mol. Its IUPAC name is ethyl (E)-2-[(4-bromophenyl)diazenyl]-4,4,4-trifluoro-3-hydroxybut-2-enoate.
| Compound Name | ethyl (E)-2-[(4-bromophenyl)diazenyl]-4,4,4-trifluoro-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 163256017 |
| Molecular Formula | C12H10BrF3N2O3 |
| Molecular Weight | 367.12 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | ethyl (E)-2-[(4-bromophenyl)diazenyl]-4,4,4-trifluoro-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1ccc(Br)cc1)=C(\O)C(F)(F)F |
| InChI | InChI=1S/C12H10BrF3N2O3/c1-2-21-11(20)9(10(19)12(14,15)16)18-17-8-5-3-7(13)4-6-8/h3-6,19H,2H2,1H3/b10-9+,18-17+ |
| InChIKey | DYTXUJDZDUIJQV-RKHHRFTBSA-N |
| XLogP | 4.43 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.12 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|