C6H6F3NO4 — CID 135528440
ethyl (E)-4,4,4-trifluoro-3-hydroxy-2-nitrosobut-2-enoate (PubChem CID 135528440) has the molecular formula C6H6F3NO4 and a molecular weight of 213.11 g/mol. Its IUPAC name is ethyl (E)-4,4,4-trifluoro-3-hydroxy-2-nitrosobut-2-enoate.
| Compound Name | ethyl (E)-4,4,4-trifluoro-3-hydroxy-2-nitrosobut-2-enoate |
|---|---|
| PubChem CID | 135528440 |
| Molecular Formula | C6H6F3NO4 |
| Molecular Weight | 213.11 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | ethyl (E)-4,4,4-trifluoro-3-hydroxy-2-nitrosobut-2-enoate |
| SMILES | CCOC(=O)/C(N=O)=C(\O)C(F)(F)F |
| InChI | InChI=1S/C6H6F3NO4/c1-2-14-5(12)3(10-13)4(11)6(7,8)9/h11H,2H2,1H3/b4-3+ |
| InChIKey | ADLCTQSTKWOPJT-ONEGZZNKSA-N |
| XLogP | 1.65 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.11 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|