C6H7Cl2NO4 — CID 175204021
ethyl 4,4-dichloro-3-hydroxy-2-nitrosobut-2-enoate (PubChem CID 175204021) has the molecular formula C6H7Cl2NO4 and a molecular weight of 228.03 g/mol. Its IUPAC name is ethyl 4,4-dichloro-3-hydroxy-2-nitrosobut-2-enoate.
| Compound Name | ethyl 4,4-dichloro-3-hydroxy-2-nitrosobut-2-enoate |
|---|---|
| PubChem CID | 175204021 |
| Molecular Formula | C6H7Cl2NO4 |
| Molecular Weight | 228.03 g/mol |
| Exact Mass | 226.98 |
| IUPAC Name | ethyl 4,4-dichloro-3-hydroxy-2-nitrosobut-2-enoate |
| SMILES | CCOC(=O)C(N=O)=C(O)C(Cl)Cl |
| InChI | InChI=1S/C6H7Cl2NO4/c1-2-13-6(11)3(9-12)4(10)5(7)8/h5,10H,2H2,1H3 |
| InChIKey | BSFWIALIVGWNOO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.03 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|