C16H15Cl2NO4S — CID 100508321
methyl 3-[(2,5-dichlorophenyl)sulfonyl-methylamino]-4-methylbenzoate (PubChem CID 100508321) has the molecular formula C16H15Cl2NO4S and a molecular weight of 388.27 g/mol. Its IUPAC name is methyl 3-[(2,5-dichlorophenyl)sulfonyl-methylamino]-4-methylbenzoate.
| Compound Name | methyl 3-[(2,5-dichlorophenyl)sulfonyl-methylamino]-4-methylbenzoate |
|---|---|
| PubChem CID | 100508321 |
| Molecular Formula | C16H15Cl2NO4S |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | methyl 3-[(2,5-dichlorophenyl)sulfonyl-methylamino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(N(C)S(=O)(=O)c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C16H15Cl2NO4S/c1-10-4-5-11(16(20)23-3)8-14(10)19(2)24(21,22)15-9-12(17)6-7-13(15)18/h4-9H,1-3H3 |
| InChIKey | OQQDCFPJUMIHHY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |