C15H13Cl2NO4S — CID 100509417
methyl 3-[(2,5-dichlorophenyl)sulfonyl-methylamino]benzoate (PubChem CID 100509417) has the molecular formula C15H13Cl2NO4S and a molecular weight of 374.25 g/mol. Its IUPAC name is methyl 3-[(2,5-dichlorophenyl)sulfonyl-methylamino]benzoate.
| Compound Name | methyl 3-[(2,5-dichlorophenyl)sulfonyl-methylamino]benzoate |
|---|---|
| PubChem CID | 100509417 |
| Molecular Formula | C15H13Cl2NO4S |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | methyl 3-[(2,5-dichlorophenyl)sulfonyl-methylamino]benzoate |
| SMILES | COC(=O)c1cccc(N(C)S(=O)(=O)c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C15H13Cl2NO4S/c1-18(12-5-3-4-10(8-12)15(19)22-2)23(20,21)14-9-11(16)6-7-13(14)17/h3-9H,1-2H3 |
| InChIKey | ABIYKCCLMKOPJE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |