C14H11ClNO4S- — CID 2345454
3-[(3-chlorophenyl)-methylsulfamoyl]benzoate (PubChem CID 2345454) has the molecular formula C14H11ClNO4S- and a molecular weight of 324.77 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)-methylsulfamoyl]benzoate.
| Compound Name | 3-[(3-chlorophenyl)-methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 2345454 |
| Molecular Formula | C14H11ClNO4S- |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 3-[(3-chlorophenyl)-methylsulfamoyl]benzoate |
| SMILES | CN(c1cccc(Cl)c1)S(=O)(=O)c1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C14H12ClNO4S/c1-16(12-6-3-5-11(15)9-12)21(19,20)13-7-2-4-10(8-13)14(17)18/h2-9H,1H3,(H,17,18)/p-1 |
| InChIKey | YXSFTRWOVSFWNH-UHFFFAOYSA-M |
| XLogP | 1.53 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |