C20H23ClN2O5S — CID 55343956
methyl 2-[[3-[(3-chlorophenyl)-methylsulfamoyl]benzoyl]amino]-3-methylbutanoate (PubChem CID 55343956) has the molecular formula C20H23ClN2O5S and a molecular weight of 438.93 g/mol. Its IUPAC name is methyl 2-[[3-[(3-chlorophenyl)-methylsulfamoyl]benzoyl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[3-[(3-chlorophenyl)-methylsulfamoyl]benzoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55343956 |
| Molecular Formula | C20H23ClN2O5S |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | methyl 2-[[3-[(3-chlorophenyl)-methylsulfamoyl]benzoyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)c1cccc(S(=O)(=O)N(C)c2cccc(Cl)c2)c1)C(C)C |
| InChI | InChI=1S/C20H23ClN2O5S/c1-13(2)18(20(25)28-4)22-19(24)14-7-5-10-17(11-14)29(26,27)23(3)16-9-6-8-15(21)12-16/h5-13,18H,1-4H3,(H,22,24) |
| InChIKey | KVBNWLOGAQIOOX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |