C23H18ClN3O3S — CID 55784053
3-[(3-chlorophenyl)-methylsulfamoyl]-N-quinolin-6-ylbenzamide (PubChem CID 55784053) has the molecular formula C23H18ClN3O3S and a molecular weight of 451.94 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)-methylsulfamoyl]-N-quinolin-6-ylbenzamide.
| Compound Name | 3-[(3-chlorophenyl)-methylsulfamoyl]-N-quinolin-6-ylbenzamide |
|---|---|
| PubChem CID | 55784053 |
| Molecular Formula | C23H18ClN3O3S |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 3-[(3-chlorophenyl)-methylsulfamoyl]-N-quinolin-6-ylbenzamide |
| SMILES | CN(c1cccc(Cl)c1)S(=O)(=O)c1cccc(C(=O)Nc2ccc3ncccc3c2)c1 |
| InChI | InChI=1S/C23H18ClN3O3S/c1-27(20-8-3-7-18(24)15-20)31(29,30)21-9-2-5-17(14-21)23(28)26-19-10-11-22-16(13-19)6-4-12-25-22/h2-15H,1H3,(H,26,28) |
| InChIKey | VKNRELIYKWFZJT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |