C11H12ClNO6S — CID 50894486
5-[carboxymethyl(ethylsulfonyl)amino]-2-chlorobenzoic acid (PubChem CID 50894486) has the molecular formula C11H12ClNO6S and a molecular weight of 321.74 g/mol. Its IUPAC name is 5-[carboxymethyl(ethylsulfonyl)amino]-2-chlorobenzoic acid.
| Compound Name | 5-[carboxymethyl(ethylsulfonyl)amino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 50894486 |
| Molecular Formula | C11H12ClNO6S |
| Molecular Weight | 321.74 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 5-[carboxymethyl(ethylsulfonyl)amino]-2-chlorobenzoic acid |
| SMILES | CCS(=O)(=O)N(CC(=O)O)c1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H12ClNO6S/c1-2-20(18,19)13(6-10(14)15)7-3-4-9(12)8(5-7)11(16)17/h3-5H,2,6H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | KFDVBZSAPSXJGH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.74 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |