C14H13Cl2N3O2 — CID 88922466
2-chloro-5-[(2-chloropyrimidin-4-yl)-propylamino]benzoic acid (PubChem CID 88922466) has the molecular formula C14H13Cl2N3O2 and a molecular weight of 326.18 g/mol. Its IUPAC name is 2-chloro-5-[(2-chloropyrimidin-4-yl)-propylamino]benzoic acid.
| Compound Name | 2-chloro-5-[(2-chloropyrimidin-4-yl)-propylamino]benzoic acid |
|---|---|
| PubChem CID | 88922466 |
| Molecular Formula | C14H13Cl2N3O2 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 2-chloro-5-[(2-chloropyrimidin-4-yl)-propylamino]benzoic acid |
| SMILES | CCCN(c1ccc(Cl)c(C(=O)O)c1)c1ccnc(Cl)n1 |
| InChI | InChI=1S/C14H13Cl2N3O2/c1-2-7-19(12-5-6-17-14(16)18-12)9-3-4-11(15)10(8-9)13(20)21/h3-6,8H,2,7H2,1H3,(H,20,21) |
| InChIKey | RTCPSBRODJFYCZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |