C21H26Cl2N4O2 — CID 88922633
2-chloro-5-[(2-chloropyrimidin-4-yl)-propan-2-ylamino]-N-[cyclohexyl(hydroxy)methyl]benzamide (PubChem CID 88922633) has the molecular formula C21H26Cl2N4O2 and a molecular weight of 437.37 g/mol. Its IUPAC name is 2-chloro-5-[(2-chloropyrimidin-4-yl)-propan-2-ylamino]-N-[cyclohexyl(hydroxy)methyl]benzamide.
| Compound Name | 2-chloro-5-[(2-chloropyrimidin-4-yl)-propan-2-ylamino]-N-[cyclohexyl(hydroxy)methyl]benzamide |
|---|---|
| PubChem CID | 88922633 |
| Molecular Formula | C21H26Cl2N4O2 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 2-chloro-5-[(2-chloropyrimidin-4-yl)-propan-2-ylamino]-N-[cyclohexyl(hydroxy)methyl]benzamide |
| SMILES | CC(C)N(c1ccc(Cl)c(C(=O)NC(O)C2CCCCC2)c1)c1ccnc(Cl)n1 |
| InChI | InChI=1S/C21H26Cl2N4O2/c1-13(2)27(18-10-11-24-21(23)25-18)15-8-9-17(22)16(12-15)20(29)26-19(28)14-6-4-3-5-7-14/h8-14,19,28H,3-7H2,1-2H3,(H,26,29) |
| InChIKey | ZFJPPXPEJHWKEW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|