C19H24ClN3O2 — CID 69054063
2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-(2-methylpyrazol-3-yl)benzamide (PubChem CID 69054063) has the molecular formula C19H24ClN3O2 and a molecular weight of 361.87 g/mol. Its IUPAC name is 2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-(2-methylpyrazol-3-yl)benzamide.
| Compound Name | 2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-(2-methylpyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 69054063 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-(2-methylpyrazol-3-yl)benzamide |
| SMILES | Cn1nccc1-c1ccc(Cl)c(C(=O)NC(O)C2CCCCCC2)c1 |
| InChI | InChI=1S/C19H24ClN3O2/c1-23-17(10-11-21-23)14-8-9-16(20)15(12-14)19(25)22-18(24)13-6-4-2-3-5-7-13/h8-13,18,24H,2-7H2,1H3,(H,22,25) |
| InChIKey | TZFNNPHDETWDLB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|