C21H26ClN3O4 — CID 18438701
2-[3-[4-chloro-3-[[cycloheptyl(hydroxy)methyl]carbamoyl]phenyl]-5-methylpyrazol-1-yl]acetic acid (PubChem CID 18438701) has the molecular formula C21H26ClN3O4 and a molecular weight of 419.91 g/mol. Its IUPAC name is 2-[3-[4-chloro-3-[[cycloheptyl(hydroxy)methyl]carbamoyl]phenyl]-5-methylpyrazol-1-yl]acetic acid.
| Compound Name | 2-[3-[4-chloro-3-[[cycloheptyl(hydroxy)methyl]carbamoyl]phenyl]-5-methylpyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 18438701 |
| Molecular Formula | C21H26ClN3O4 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 2-[3-[4-chloro-3-[[cycloheptyl(hydroxy)methyl]carbamoyl]phenyl]-5-methylpyrazol-1-yl]acetic acid |
| SMILES | Cc1cc(-c2ccc(Cl)c(C(=O)NC(O)C3CCCCCC3)c2)nn1CC(=O)O |
| InChI | InChI=1S/C21H26ClN3O4/c1-13-10-18(24-25(13)12-19(26)27)15-8-9-17(22)16(11-15)21(29)23-20(28)14-6-4-2-3-5-7-14/h8-11,14,20,28H,2-7,12H2,1H3,(H,23,29)(H,26,27) |
| InChIKey | STJZYDZAGWVKEG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|