C22H32Cl2N4O3 — CID 18438702
5-[1-(3-amino-2-hydroxypropyl)-5-methylpyrazol-3-yl]-2-chloro-N-[cycloheptyl(hydroxy)methyl]benzamide;hydrochloride (PubChem CID 18438702) has the molecular formula C22H32Cl2N4O3 and a molecular weight of 471.43 g/mol. Its IUPAC name is 5-[1-(3-amino-2-hydroxypropyl)-5-methylpyrazol-3-yl]-2-chloro-N-[cycloheptyl(hydroxy)methyl]benzamide;hydrochloride.
| Compound Name | 5-[1-(3-amino-2-hydroxypropyl)-5-methylpyrazol-3-yl]-2-chloro-N-[cycloheptyl(hydroxy)methyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 18438702 |
| Molecular Formula | C22H32Cl2N4O3 |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 5-[1-(3-amino-2-hydroxypropyl)-5-methylpyrazol-3-yl]-2-chloro-N-[cycloheptyl(hydroxy)methyl]benzamide;hydrochloride |
| SMILES | Cc1cc(-c2ccc(Cl)c(C(=O)NC(O)C3CCCCCC3)c2)nn1CC(O)CN.Cl |
| InChI | InChI=1S/C22H31ClN4O3.ClH/c1-14-10-20(26-27(14)13-17(28)12-24)16-8-9-19(23)18(11-16)22(30)25-21(29)15-6-4-2-3-5-7-15;/h8-11,15,17,21,28-29H,2-7,12-13,24H2,1H3,(H,25,30);1H |
| InChIKey | OBBNQLKFZQSCEJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|