C17H21ClN4O3 — CID 135714879
2-chloro-N-[cyclohexyl(hydroxy)methyl]-5-(3-methyl-5-oxo-4H-1,2,4-triazol-1-yl)benzamide (PubChem CID 135714879) has the molecular formula C17H21ClN4O3 and a molecular weight of 364.83 g/mol. Its IUPAC name is 2-chloro-N-[cyclohexyl(hydroxy)methyl]-5-(3-methyl-5-oxo-4H-1,2,4-triazol-1-yl)benzamide.
| Compound Name | 2-chloro-N-[cyclohexyl(hydroxy)methyl]-5-(3-methyl-5-oxo-4H-1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 135714879 |
| Molecular Formula | C17H21ClN4O3 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 2-chloro-N-[cyclohexyl(hydroxy)methyl]-5-(3-methyl-5-oxo-4H-1,2,4-triazol-1-yl)benzamide |
| SMILES | Cc1nn(-c2ccc(Cl)c(C(=O)NC(O)C3CCCCC3)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H21ClN4O3/c1-10-19-17(25)22(21-10)12-7-8-14(18)13(9-12)16(24)20-15(23)11-5-3-2-4-6-11/h7-9,11,15,23H,2-6H2,1H3,(H,20,24)(H,19,21,25) |
| InChIKey | YPLITLICSKIESC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|