C21H26ClN5O5 — CID 22267540
2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-[4-(2-formamidoethyl)-3,5-dioxo-1,2,4-triazin-2-yl]benzamide (PubChem CID 22267540) has the molecular formula C21H26ClN5O5 and a molecular weight of 463.92 g/mol. Its IUPAC name is 2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-[4-(2-formamidoethyl)-3,5-dioxo-1,2,4-triazin-2-yl]benzamide.
| Compound Name | 2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-[4-(2-formamidoethyl)-3,5-dioxo-1,2,4-triazin-2-yl]benzamide |
|---|---|
| PubChem CID | 22267540 |
| Molecular Formula | C21H26ClN5O5 |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-[4-(2-formamidoethyl)-3,5-dioxo-1,2,4-triazin-2-yl]benzamide |
| SMILES | O=CNCCn1c(=O)cnn(-c2ccc(Cl)c(C(=O)NC(O)C3CCCCCC3)c2)c1=O |
| InChI | InChI=1S/C21H26ClN5O5/c22-17-8-7-15(27-21(32)26(10-9-23-13-28)18(29)12-24-27)11-16(17)20(31)25-19(30)14-5-3-1-2-4-6-14/h7-8,11-14,19,30H,1-6,9-10H2,(H,23,28)(H,25,31) |
| InChIKey | CXAOSTRYUYPLHD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 135.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|